C31H5F12N7 — CID 176690252
(3Z,6Z)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile (PubChem CID 176690252) has the molecular formula C31H5F12N7 and a molecular weight of 703.41 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile.
| Compound Name | (3Z,6Z)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 176690252 |
| Molecular Formula | C31H5F12N7 |
| Molecular Weight | 703.41 g/mol |
| Exact Mass | 703.04 |
| IUPAC Name | (3Z,6Z)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
| SMILES | N#C/C(c1cc(C#N)cc(C(F)(F)F)c1C(F)(F)F)=c1/cc(C#N)/c(=C(/C#N)c2cc(C#N)cc(C(F)(F)F)c2C(F)(F)F)c(C#N)c1C#N |
| InChI | InChI=1S/C31H5F12N7/c32-28(33,34)23-3-13(6-44)1-17(26(23)30(38,39)40)19(9-47)16-5-15(8-46)25(22(12-50)20(16)10-48)21(11-49)18-2-14(7-45)4-24(29(35,36)37)27(18)31(41,42)43/h1-5H/b19-16+,25-21+ |
| InChIKey | DUQFRSQMZSMNTN-HNHUZTSLSA-N |
| XLogP | 6.57 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |