C31H5F6N9 — CID 176690278
(3E,6E)-3,6-bis[cyano-[2,5-dicyano-3-(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile (PubChem CID 176690278) has the molecular formula C31H5F6N9 and a molecular weight of 617.43 g/mol. Its IUPAC name is (3E,6E)-3,6-bis[cyano-[2,5-dicyano-3-(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile.
| Compound Name | (3E,6E)-3,6-bis[cyano-[2,5-dicyano-3-(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 176690278 |
| Molecular Formula | C31H5F6N9 |
| Molecular Weight | 617.43 g/mol |
| Exact Mass | 617.06 |
| IUPAC Name | (3E,6E)-3,6-bis[cyano-[2,5-dicyano-3-(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
| SMILES | N#C/C(c1cc(C#N)cc(C(F)(F)F)c1C#N)=c1\cc(C#N)/c(=C(\C#N)c2cc(C#N)cc(C(F)(F)F)c2C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C31H5F6N9/c32-30(33,34)27-3-15(6-38)1-18(23(27)11-43)21(9-41)20-5-17(8-40)29(26(14-46)22(20)10-42)25(13-45)19-2-16(7-39)4-28(24(19)12-44)31(35,36)37/h1-5H/b21-20-,29-25- |
| InChIKey | PJWIRGLSAHKPCX-NBPXMDSUSA-N |
| XLogP | 4.27 |
| TPSA | 214.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |