C29H7N9 — CID 176690214
(3Z,6Z)-3,6-bis[cyano-(3,4-dicyanophenyl)methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile (PubChem CID 176690214) has the molecular formula C29H7N9 and a molecular weight of 481.44 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[cyano-(3,4-dicyanophenyl)methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile.
| Compound Name | (3Z,6Z)-3,6-bis[cyano-(3,4-dicyanophenyl)methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 176690214 |
| Molecular Formula | C29H7N9 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | (3Z,6Z)-3,6-bis[cyano-(3,4-dicyanophenyl)methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
| SMILES | N#C/C(c1ccc(C#N)c(C#N)c1)=c1/cc(C#N)/c(=C(/C#N)c2ccc(C#N)c(C#N)c2)c(C#N)c1C#N |
| InChI | InChI=1S/C29H7N9/c30-8-19-3-1-17(5-21(19)10-32)25(13-35)24-7-23(12-34)29(28(16-38)27(24)15-37)26(14-36)18-2-4-20(9-31)22(6-18)11-33/h1-7H/b25-24+,29-26+ |
| InChIKey | KYBSUBFFKFOCST-QBNKLHLHSA-N |
| XLogP | 2.23 |
| TPSA | 214.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |