C33H3F12N9 — CID 176690258
(3Z,6Z)-3,6-bis[cyano-[2,5-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile (PubChem CID 176690258) has the molecular formula C33H3F12N9 and a molecular weight of 753.43 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[cyano-[2,5-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile.
| Compound Name | (3Z,6Z)-3,6-bis[cyano-[2,5-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 176690258 |
| Molecular Formula | C33H3F12N9 |
| Molecular Weight | 753.43 g/mol |
| Exact Mass | 753.03 |
| IUPAC Name | (3Z,6Z)-3,6-bis[cyano-[2,5-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
| SMILES | N#C/C(c1cc(C#N)c(C(F)(F)F)c(C(F)(F)F)c1C#N)=c1/cc(C#N)/c(=C(/C#N)c2cc(C#N)c(C(F)(F)F)c(C(F)(F)F)c2C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C33H3F12N9/c34-30(35,36)26-14(5-47)2-17(23(11-53)28(26)32(40,41)42)19(7-49)16-1-13(4-46)25(22(10-52)20(16)8-50)21(9-51)18-3-15(6-48)27(31(37,38)39)29(24(18)12-54)33(43,44)45/h1-3H/b19-16+,25-21+ |
| InChIKey | YMWWDYLMXVTFFY-HNHUZTSLSA-N |
| XLogP | 6.31 |
| TPSA | 214.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |