C29H3F12N9 — CID 176690207
(3Z,6E)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)-4-pyridinyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile (PubChem CID 176690207) has the molecular formula C29H3F12N9 and a molecular weight of 705.38 g/mol. Its IUPAC name is (3Z,6E)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)-4-pyridinyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile.
| Compound Name | (3Z,6E)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)-4-pyridinyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 176690207 |
| Molecular Formula | C29H3F12N9 |
| Molecular Weight | 705.38 g/mol |
| Exact Mass | 705.03 |
| IUPAC Name | (3Z,6E)-3,6-bis[cyano-[5-cyano-2,3-bis(trifluoromethyl)-4-pyridinyl]methylidene]cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
| SMILES | N#C/C(c1c(C#N)cnc(C(F)(F)F)c1C(F)(F)F)=c1/c(C#N)c/c(=C(\C#N)c2c(C#N)cnc(C(F)(F)F)c2C(F)(F)F)c(C#N)c1C#N |
| InChI | InChI=1S/C29H3F12N9/c30-26(31,32)22-20(12(3-43)9-49-24(22)28(36,37)38)16(6-46)14-1-11(2-42)19(17(7-47)15(14)5-45)18(8-48)21-13(4-44)10-50-25(29(39,40)41)23(21)27(33,34)35/h1,9-10H/b16-14-,19-18+ |
| InChIKey | ABZCZDZGOVRKRW-VVKZTZMDSA-N |
| XLogP | 5.36 |
| TPSA | 192.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |