C21HF4N7 — CID 176689872
(3Z)-3-[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4-tricarbonitrile (PubChem CID 176689872) has the molecular formula C21HF4N7 and a molecular weight of 427.28 g/mol. Its IUPAC name is (3Z)-3-[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4-tricarbonitrile.
| Compound Name | (3Z)-3-[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 176689872 |
| Molecular Formula | C21HF4N7 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | (3Z)-3-[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4-tricarbonitrile |
| SMILES | N#CC(C#N)=c1cc(C#N)/c(=C(/C#N)c2c(F)c(F)c(C#N)c(F)c2F)c(C#N)c1C#N |
| InChI | InChI=1S/C21HF4N7/c22-18-15(8-32)19(23)21(25)17(20(18)24)14(7-31)16-9(2-26)1-11(10(3-27)4-28)12(5-29)13(16)6-30/h1H/b16-14+ |
| InChIKey | NLFTUJKWNCYFJG-JQIJEIRASA-N |
| XLogP | 1.65 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|