C26H7F14N5 — CID 175619361
(3E,6Z)-3,6-bis[[2,6-bis(trifluoromethyl)-4-pyridinyl]-cyanomethylidene]-2,5-difluoro-4-methylcyclohexa-1,4-diene-1-carbonitrile (PubChem CID 175619361) has the molecular formula C26H7F14N5 and a molecular weight of 655.35 g/mol. Its IUPAC name is (3E,6Z)-3,6-bis[[2,6-bis(trifluoromethyl)-4-pyridinyl]-cyanomethylidene]-2,5-difluoro-4-methylcyclohexa-1,4-diene-1-carbonitrile.
| Compound Name | (3E,6Z)-3,6-bis[[2,6-bis(trifluoromethyl)-4-pyridinyl]-cyanomethylidene]-2,5-difluoro-4-methylcyclohexa-1,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 175619361 |
| Molecular Formula | C26H7F14N5 |
| Molecular Weight | 655.35 g/mol |
| Exact Mass | 655.05 |
| IUPAC Name | (3E,6Z)-3,6-bis[[2,6-bis(trifluoromethyl)-4-pyridinyl]-cyanomethylidene]-2,5-difluoro-4-methylcyclohexa-1,4-diene-1-carbonitrile |
| SMILES | Cc1c(F)/c(=C(\C#N)c2cc(C(F)(F)F)nc(C(F)(F)F)c2)c(C#N)c(F)/c1=C(/C#N)c1cc(C(F)(F)F)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H7F14N5/c1-9-19(12(6-41)10-2-15(23(29,30)31)44-16(3-10)24(32,33)34)22(28)14(8-43)20(21(9)27)13(7-42)11-4-17(25(35,36)37)45-18(5-11)26(38,39)40/h2-5H,1H3/b19-12-,20-13+ |
| InChIKey | RCPIYXVEUYRAEL-ZEDXCMECSA-N |
| XLogP | 6.46 |
| TPSA | 97.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.35 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |