C23H9F9N4O2 — CID 89281139
[2-[3,5-bis(trifluoromethyl)phenoxy]-4-cyanoimino-5-[3-(trifluoromethyl)phenoxy]cyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 89281139) has the molecular formula C23H9F9N4O2 and a molecular weight of 544.33 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)phenoxy]-4-cyanoimino-5-[3-(trifluoromethyl)phenoxy]cyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [2-[3,5-bis(trifluoromethyl)phenoxy]-4-cyanoimino-5-[3-(trifluoromethyl)phenoxy]cyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 89281139 |
| Molecular Formula | C23H9F9N4O2 |
| Molecular Weight | 544.33 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)phenoxy]-4-cyanoimino-5-[3-(trifluoromethyl)phenoxy]cyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | N#C/N=C1\C=C(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)/C(=N/C#N)C=C1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H9F9N4O2/c24-21(25,26)12-2-1-3-15(5-12)37-19-8-18(36-11-34)20(9-17(19)35-10-33)38-16-6-13(22(27,28)29)4-14(7-16)23(30,31)32/h1-9H/b35-17+,36-18+ |
| InChIKey | YUVSSYNJIOKVTR-PKRYOZTKSA-N |
| XLogP | 6.83 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.33 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|