C10H9N3S2 — CID 11368342
(3-phenylsulfanyl-1,3-thiazolidin-2-ylidene)cyanamide (PubChem CID 11368342) has the molecular formula C10H9N3S2 and a molecular weight of 235.34 g/mol. Its IUPAC name is (3-phenylsulfanyl-1,3-thiazolidin-2-ylidene)cyanamide.
| Compound Name | (3-phenylsulfanyl-1,3-thiazolidin-2-ylidene)cyanamide |
|---|---|
| PubChem CID | 11368342 |
| Molecular Formula | C10H9N3S2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | (3-phenylsulfanyl-1,3-thiazolidin-2-ylidene)cyanamide |
| SMILES | N#C/N=C1\SCCN1Sc1ccccc1 |
| InChI | InChI=1S/C10H9N3S2/c11-8-12-10-13(6-7-14-10)15-9-4-2-1-3-5-9/h1-5H,6-7H2/b12-10- |
| InChIKey | GPKVCJCPUYNNQO-BENRWUELSA-N |
| XLogP | 2.58 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|