C22H18S2Se — CID 14922924
2-(2,6-diphenylselenopyran-4-ylidene)-4,5-dimethyl-1,3-dithiole (PubChem CID 14922924) has the molecular formula C22H18S2Se and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(2,6-diphenylselenopyran-4-ylidene)-4,5-dimethyl-1,3-dithiole.
| Compound Name | 2-(2,6-diphenylselenopyran-4-ylidene)-4,5-dimethyl-1,3-dithiole |
|---|---|
| PubChem CID | 14922924 |
| Molecular Formula | C22H18S2Se |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 2-(2,6-diphenylselenopyran-4-ylidene)-4,5-dimethyl-1,3-dithiole |
| SMILES | CC1=C(C)SC(=C2C=C(c3ccccc3)[Se]C(c3ccccc3)=C2)S1 |
| InChI | InChI=1S/C22H18S2Se/c1-15-16(2)24-22(23-15)19-13-20(17-9-5-3-6-10-17)25-21(14-19)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| InChIKey | VSUCFEIFXSAJLE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|