C13H14Br2Si — CID 11175760
(1,3-dibromoazulen-2-yl)-trimethylsilane (PubChem CID 11175760) has the molecular formula C13H14Br2Si and a molecular weight of 358.15 g/mol. Its IUPAC name is (1,3-dibromoazulen-2-yl)-trimethylsilane.
| Compound Name | (1,3-dibromoazulen-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 11175760 |
| Molecular Formula | C13H14Br2Si |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | (1,3-dibromoazulen-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1c(Br)c2cccccc-2c1Br |
| InChI | InChI=1S/C13H14Br2Si/c1-16(2,3)13-11(14)9-7-5-4-6-8-10(9)12(13)15/h4-8H,1-3H3 |
| InChIKey | JWOSPMJBJCNLRE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|