C20H30Cl2Si — CID 139699590
bis(4-tert-butyl-2-methylcyclopenta-2,4-dien-1-yl)-dichlorosilane (PubChem CID 139699590) has the molecular formula C20H30Cl2Si and a molecular weight of 369.45 g/mol. Its IUPAC name is bis(4-tert-butyl-2-methylcyclopenta-2,4-dien-1-yl)-dichlorosilane.
| Compound Name | bis(4-tert-butyl-2-methylcyclopenta-2,4-dien-1-yl)-dichlorosilane |
|---|---|
| PubChem CID | 139699590 |
| Molecular Formula | C20H30Cl2Si |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | bis(4-tert-butyl-2-methylcyclopenta-2,4-dien-1-yl)-dichlorosilane |
| SMILES | CC1=CC(C(C)(C)C)=CC1[Si](Cl)(Cl)C1C=C(C(C)(C)C)C=C1C |
| InChI | InChI=1S/C20H30Cl2Si/c1-13-9-15(19(3,4)5)11-17(13)23(21,22)18-12-16(10-14(18)2)20(6,7)8/h9-12,17-18H,1-8H3 |
| InChIKey | QJWQCRROSBBVKQ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|