C38H62 — CID 15250287
1,3,5-tritert-butyl-7-(2,4,6-tritert-butylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene (PubChem CID 15250287) has the molecular formula C38H62 and a molecular weight of 518.91 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-7-(2,4,6-tritert-butylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene.
| Compound Name | 1,3,5-tritert-butyl-7-(2,4,6-tritert-butylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 15250287 |
| Molecular Formula | C38H62 |
| Molecular Weight | 518.91 g/mol |
| Exact Mass | 518.49 |
| IUPAC Name | 1,3,5-tritert-butyl-7-(2,4,6-tritert-butylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)=CC(C2C=C(C(C)(C)C)C=C(C(C)(C)C)C=C2C(C)(C)C)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C38H62/c1-33(2,3)25-19-27(35(7,8)9)23-31(37(13,14)15)29(21-25)30-22-26(34(4,5)6)20-28(36(10,11)12)24-32(30)38(16,17)18/h19-24,29-30H,1-18H3 |
| InChIKey | GRDIDZLXKNFCSS-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.91 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |