C22H32 — CID 101410468
1,3-ditert-butyl-5-[(E)-4-cyclopenta-2,4-dien-1-ylbut-2-enyl]cyclopenta-1,3-diene (PubChem CID 101410468) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[(E)-4-cyclopenta-2,4-dien-1-ylbut-2-enyl]cyclopenta-1,3-diene.
| Compound Name | 1,3-ditert-butyl-5-[(E)-4-cyclopenta-2,4-dien-1-ylbut-2-enyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 101410468 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1,3-ditert-butyl-5-[(E)-4-cyclopenta-2,4-dien-1-ylbut-2-enyl]cyclopenta-1,3-diene |
| SMILES | CC(C)(C)C1=CC(C/C=C/CC2C=CC=C2)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C22H32/c1-21(2,3)19-15-18(20(16-19)22(4,5)6)14-10-9-13-17-11-7-8-12-17/h7-12,15-18H,13-14H2,1-6H3/b10-9+ |
| InChIKey | RQZMBRZCBBPWME-MDZDMXLPSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|