C19H35P — CID 134913041
2,4,6-tritert-butyl-1,1-dimethyl-1λ5-phosphacyclohexa-1,3,5-triene (PubChem CID 134913041) has the molecular formula C19H35P and a molecular weight of 294.46 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-1,1-dimethyl-1λ5-phosphacyclohexa-1,3,5-triene.
| Compound Name | 2,4,6-tritert-butyl-1,1-dimethyl-1λ5-phosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 134913041 |
| Molecular Formula | C19H35P |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2,4,6-tritert-butyl-1,1-dimethyl-1λ5-phosphacyclohexa-1,3,5-triene |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)=P(C)(C)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C19H35P/c1-17(2,3)14-12-15(18(4,5)6)20(10,11)16(13-14)19(7,8)9/h12-13H,1-11H3 |
| InChIKey | KIVUVGUNDDPXNO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|