C15H27BO3 — CID 155669325
(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 155669325) has the molecular formula C15H27BO3 and a molecular weight of 266.19 g/mol. Its IUPAC name is (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 155669325 |
| Molecular Formula | C15H27BO3 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | COC1(B(O)O)C=C(C(C)(C)C)C=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27BO3/c1-13(2,3)11-8-12(14(4,5)6)10-15(9-11,19-7)16(17)18/h8-9,17-18H,10H2,1-7H3 |
| InChIKey | IOEYPOZTUXNDPD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|