(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid

C15H27BO3 — CID 155669325

IUPAC(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid
SMILESCOC1(B(O)O)C=C(C(C)(C)C)C=C(C(C)(C)C)C1
InChIInChI=1S/C15H27BO3/c1-13(2,3)11-8-12(14(4,5)6)10-15(9-11,19-7)16(17)18/h8-9,17-18H,10H2,1-7H3
InChIKeyIOEYPOZTUXNDPD-UHFFFAOYSA-N
MW266.19 g/mol
LogP2.73
Rot. Bonds2

About (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid

(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 155669325) has the molecular formula C15H27BO3 and a molecular weight of 266.19 g/mol. Its IUPAC name is (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid.

Molecular Properties

Compound Name(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid
PubChem CID155669325
Molecular FormulaC15H27BO3
Molecular Weight266.19 g/mol
Exact Mass266.21
IUPAC Name(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid
SMILESCOC1(B(O)O)C=C(C(C)(C)C)C=C(C(C)(C)C)C1
InChIInChI=1S/C15H27BO3/c1-13(2,3)11-8-12(14(4,5)6)10-15(9-11,19-7)16(17)18/h8-9,17-18H,10H2,1-7H3
InChIKeyIOEYPOZTUXNDPD-UHFFFAOYSA-N
XLogP2.73
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.19
LogP ≤ 52.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid?
The IUPAC name of (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid (CID 155669325) is (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid.
What is the SMILES notation for (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid?
The canonical SMILES for (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid is COC1(B(O)O)C=C(C(C)(C)C)C=C(C(C)(C)C)C1.
What is the InChIKey of (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid?
The InChIKey is IOEYPOZTUXNDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27BO3/c1-13(2,3)11-8-12(14(4,5)6)10-15(9-11,19-7)16(17)18/h8-9,17-18H,10H2,1-7H3.
What are the key properties of (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid?
(3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid has a molecular weight of 266.19 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)boronic acid is sourced from PubChem (CID 155669325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).