C27H34O4S2 — CID 11329245
6,6-bis(benzenesulfonyl)-1,3-ditert-butylcyclohepta-1,3-diene (PubChem CID 11329245) has the molecular formula C27H34O4S2 and a molecular weight of 486.70 g/mol. Its IUPAC name is 6,6-bis(benzenesulfonyl)-1,3-ditert-butylcyclohepta-1,3-diene.
| Compound Name | 6,6-bis(benzenesulfonyl)-1,3-ditert-butylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 11329245 |
| Molecular Formula | C27H34O4S2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 6,6-bis(benzenesulfonyl)-1,3-ditert-butylcyclohepta-1,3-diene |
| SMILES | CC(C)(C)C1=CCC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C27H34O4S2/c1-25(2,3)21-17-18-27(20-22(19-21)26(4,5)6,32(28,29)23-13-9-7-10-14-23)33(30,31)24-15-11-8-12-16-24/h7-17,19H,18,20H2,1-6H3 |
| InChIKey | HLFYUCUPQKMSIK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |