C15H18O2S — CID 10956368
(1S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]hept-2-ene (PubChem CID 10956368) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is (1S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]hept-2-ene.
| Compound Name | (1S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]hept-2-ene |
|---|---|
| PubChem CID | 10956368 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (1S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]hept-2-ene |
| SMILES | CC1=CC[C@@]2(C)CC[C@@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O2S/c1-12-8-9-14(2)10-11-15(12,14)18(16,17)13-6-4-3-5-7-13/h3-8H,9-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | OFPPVRJUZBPXNH-LSDHHAIUSA-N |
| XLogP | 3.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|