C15H19NO2S — CID 94036916
(1S,6R)-7-(benzenesulfonyl)-1,6-dimethyl-7-azabicyclo[4.2.0]oct-3-ene (PubChem CID 94036916) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is (1S,6R)-7-(benzenesulfonyl)-1,6-dimethyl-7-azabicyclo[4.2.0]oct-3-ene.
| Compound Name | (1S,6R)-7-(benzenesulfonyl)-1,6-dimethyl-7-azabicyclo[4.2.0]oct-3-ene |
|---|---|
| PubChem CID | 94036916 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (1S,6R)-7-(benzenesulfonyl)-1,6-dimethyl-7-azabicyclo[4.2.0]oct-3-ene |
| SMILES | C[C@@]12CC=CC[C@@]1(C)N(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H19NO2S/c1-14-10-6-7-11-15(14,2)16(12-14)19(17,18)13-8-4-3-5-9-13/h3-9H,10-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | NNWXPGBOXJOHCV-LSDHHAIUSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|