C14H17BN2O4S — CID 53406834
1-(benzenesulfonyl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazole (PubChem CID 53406834) has the molecular formula C14H17BN2O4S and a molecular weight of 320.18 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazole.
| Compound Name | 1-(benzenesulfonyl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazole |
|---|---|
| PubChem CID | 53406834 |
| Molecular Formula | C14H17BN2O4S |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazole |
| SMILES | CC1(C)COB(c2cnn(S(=O)(=O)c3ccccc3)c2)OC1 |
| InChI | InChI=1S/C14H17BN2O4S/c1-14(2)10-20-15(21-11-14)12-8-16-17(9-12)22(18,19)13-6-4-3-5-7-13/h3-9H,10-11H2,1-2H3 |
| InChIKey | ZEYVMAXVDTWFNX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|