C20H22BFN2O2 — CID 171533902
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-[(2R)-2-fluoro-2-phenylethyl]indazole (PubChem CID 171533902) has the molecular formula C20H22BFN2O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-[(2R)-2-fluoro-2-phenylethyl]indazole.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-[(2R)-2-fluoro-2-phenylethyl]indazole |
|---|---|
| PubChem CID | 171533902 |
| Molecular Formula | C20H22BFN2O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-[(2R)-2-fluoro-2-phenylethyl]indazole |
| SMILES | CC1(C)COB(c2cccc3nn(C[C@H](F)c4ccccc4)cc23)OC1 |
| InChI | InChI=1S/C20H22BFN2O2/c1-20(2)13-25-21(26-14-20)17-9-6-10-19-16(17)11-24(23-19)12-18(22)15-7-4-3-5-8-15/h3-11,18H,12-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | UIXBLQMPPKPCIV-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|