C19H25BN4O3 — CID 171534090
1-(1-methylpyrazol-4-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]ethanol (PubChem CID 171534090) has the molecular formula C19H25BN4O3 and a molecular weight of 368.25 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]ethanol.
| Compound Name | 1-(1-methylpyrazol-4-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]ethanol |
|---|---|
| PubChem CID | 171534090 |
| Molecular Formula | C19H25BN4O3 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]ethanol |
| SMILES | Cn1cc(C(O)Cn2cc3c(B4OC(C)(C)C(C)(C)O4)cccc3n2)cn1 |
| InChI | InChI=1S/C19H25BN4O3/c1-18(2)19(3,4)27-20(26-18)15-7-6-8-16-14(15)11-24(22-16)12-17(25)13-9-21-23(5)10-13/h6-11,17,25H,12H2,1-5H3 |
| InChIKey | ACNJIKJQKXSDAQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|