C18H21BO2 — CID 134949720
2-benzhydryl-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 134949720) has the molecular formula C18H21BO2 and a molecular weight of 280.18 g/mol. Its IUPAC name is 2-benzhydryl-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-benzhydryl-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 134949720 |
| Molecular Formula | C18H21BO2 |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-benzhydryl-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(C(c2ccccc2)c2ccccc2)OC1 |
| InChI | InChI=1S/C18H21BO2/c1-18(2)13-20-19(21-14-18)17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | CHLNTYVNLJAPLQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|