C24H28B2Br2O4 — CID 102189371
2-[(E)-1,2-bis(2-bromophenyl)-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 102189371) has the molecular formula C24H28B2Br2O4 and a molecular weight of 561.92 g/mol. Its IUPAC name is 2-[(E)-1,2-bis(2-bromophenyl)-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-[(E)-1,2-bis(2-bromophenyl)-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 102189371 |
| Molecular Formula | C24H28B2Br2O4 |
| Molecular Weight | 561.92 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 2-[(E)-1,2-bis(2-bromophenyl)-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(/C(=C(/B2OCC(C)(C)CO2)c2ccccc2Br)c2ccccc2Br)OC1 |
| InChI | InChI=1S/C24H28B2Br2O4/c1-23(2)13-29-25(30-14-23)21(17-9-5-7-11-19(17)27)22(18-10-6-8-12-20(18)28)26-31-15-24(3,4)16-32-26/h5-12H,13-16H2,1-4H3/b22-21+ |
| InChIKey | MGAOBIAAFLJAOT-QURGRASLSA-N |
| XLogP | 6.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.92 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|