C9H7Br3 — CID 87377327
1-bromo-2-(1,1-dibromoprop-1-en-2-yl)benzene (PubChem CID 87377327) has the molecular formula C9H7Br3 and a molecular weight of 354.87 g/mol. Its IUPAC name is 1-bromo-2-(1,1-dibromoprop-1-en-2-yl)benzene.
| Compound Name | 1-bromo-2-(1,1-dibromoprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 87377327 |
| Molecular Formula | C9H7Br3 |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 351.81 |
| IUPAC Name | 1-bromo-2-(1,1-dibromoprop-1-en-2-yl)benzene |
| SMILES | CC(=C(Br)Br)c1ccccc1Br |
| InChI | InChI=1S/C9H7Br3/c1-6(9(11)12)7-4-2-3-5-8(7)10/h2-5H,1H3 |
| InChIKey | ARABAJUKSRNFQY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |