C8H5Br3 — CID 135084466
1-bromo-2-(1,2-dibromoethenyl)benzene (PubChem CID 135084466) has the molecular formula C8H5Br3 and a molecular weight of 340.84 g/mol. Its IUPAC name is 1-bromo-2-(1,2-dibromoethenyl)benzene.
| Compound Name | 1-bromo-2-(1,2-dibromoethenyl)benzene |
|---|---|
| PubChem CID | 135084466 |
| Molecular Formula | C8H5Br3 |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 337.79 |
| IUPAC Name | 1-bromo-2-(1,2-dibromoethenyl)benzene |
| SMILES | BrC=C(Br)c1ccccc1Br |
| InChI | InChI=1S/C8H5Br3/c9-5-8(11)6-3-1-2-4-7(6)10/h1-5H |
| InChIKey | VHGJOOWEHQALKN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |