C44H46B2O4 — CID 161120912
5,5-dimethyl-2-(1,2,2-triphenylethenyl)-1,3,2-dioxaborinane;2-(2,2-diphenylethenyl)-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 161120912) has the molecular formula C44H46B2O4 and a molecular weight of 660.47 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1,2,2-triphenylethenyl)-1,3,2-dioxaborinane;2-(2,2-diphenylethenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-(1,2,2-triphenylethenyl)-1,3,2-dioxaborinane;2-(2,2-diphenylethenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 161120912 |
| Molecular Formula | C44H46B2O4 |
| Molecular Weight | 660.47 g/mol |
| Exact Mass | 660.36 |
| IUPAC Name | 5,5-dimethyl-2-(1,2,2-triphenylethenyl)-1,3,2-dioxaborinane;2-(2,2-diphenylethenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)OC1.CC1(C)COB(C=C(c2ccccc2)c2ccccc2)OC1 |
| InChI | InChI=1S/C25H25BO2.C19H21BO2/c1-25(2)18-27-26(28-19-25)24(22-16-10-5-11-17-22)23(20-12-6-3-7-13-20)21-14-8-4-9-15-21;1-19(2)14-21-20(22-15-19)13-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-17H,18-19H2,1-2H3;3-13H,14-15H2,1-2H3 |
| InChIKey | UKXXZVSQJRSIIZ-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.47 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|