C29H32O2P2S2+2 — CID 173120786
5,5-dimethyl-2,2-bis(sulfanyl)-1,3,2-dioxaphosphinan-2-ium;tetraphenylphosphanium (PubChem CID 173120786) has the molecular formula C29H32O2P2S2+2 and a molecular weight of 538.66 g/mol. Its IUPAC name is 5,5-dimethyl-2,2-bis(sulfanyl)-1,3,2-dioxaphosphinan-2-ium;tetraphenylphosphanium.
| Compound Name | 5,5-dimethyl-2,2-bis(sulfanyl)-1,3,2-dioxaphosphinan-2-ium;tetraphenylphosphanium |
|---|---|
| PubChem CID | 173120786 |
| Molecular Formula | C29H32O2P2S2+2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 5,5-dimethyl-2,2-bis(sulfanyl)-1,3,2-dioxaphosphinan-2-ium;tetraphenylphosphanium |
| SMILES | CC1(C)CO[P+](S)(S)OC1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C5H12O2PS2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5(2)3-6-8(9,10)7-4-5/h1-20H;9-10H,3-4H2,1-2H3/q2*+1 |
| InChIKey | IFGXTHQMQFCKBR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|