About palladium;tetraphenylphosphanium
palladium;tetraphenylphosphanium (PubChem CID 76575044) has the molecular formula C24H20PPd+
and a molecular weight of 445.82 g/mol. Its IUPAC name is palladium;tetraphenylphosphanium.
Molecular Properties
| Compound Name | palladium;tetraphenylphosphanium |
| PubChem CID | 76575044 |
| Molecular Formula | C24H20PPd+ |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | palladium;tetraphenylphosphanium |
| SMILES | [Pd].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.Pd/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;/q+1; |
| InChIKey | JXQLZDOXCSUANH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;tetraphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;tetraphenylphosphanium?
The IUPAC name of palladium;tetraphenylphosphanium (CID 76575044) is palladium;tetraphenylphosphanium.
What is the SMILES notation for palladium;tetraphenylphosphanium?
The canonical SMILES for palladium;tetraphenylphosphanium is [Pd].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of palladium;tetraphenylphosphanium?
The InChIKey is JXQLZDOXCSUANH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20P.Pd/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;/q+1;.
What are the key properties of palladium;tetraphenylphosphanium?
palladium;tetraphenylphosphanium has a molecular weight of 445.82 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;tetraphenylphosphanium is sourced from PubChem (CID 76575044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).