About hydrogen borate;bis(tetraphenylphosphanium)
hydrogen borate;bis(tetraphenylphosphanium) (PubChem CID 174383886) has the molecular formula C48H41BO3P2
and a molecular weight of 738.61 g/mol. Its IUPAC name is hydrogen borate;bis(tetraphenylphosphanium).
Molecular Properties
| Compound Name | hydrogen borate;bis(tetraphenylphosphanium) |
| PubChem CID | 174383886 |
| Molecular Formula | C48H41BO3P2 |
| Molecular Weight | 738.61 g/mol |
| Exact Mass | 738.26 |
| IUPAC Name | hydrogen borate;bis(tetraphenylphosphanium) |
| SMILES | [O-]B([O-])O.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C24H20P.BHO3/c2*1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3)4/h2*1-20H;2H/q2*+1;-2 |
| InChIKey | GHHGDDXFGDETFX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydrogen borate;bis(tetraphenylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen borate;bis(tetraphenylphosphanium)?
The IUPAC name of hydrogen borate;bis(tetraphenylphosphanium) (CID 174383886) is hydrogen borate;bis(tetraphenylphosphanium).
What is the SMILES notation for hydrogen borate;bis(tetraphenylphosphanium)?
The canonical SMILES for hydrogen borate;bis(tetraphenylphosphanium) is [O-]B([O-])O.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hydrogen borate;bis(tetraphenylphosphanium)?
The InChIKey is GHHGDDXFGDETFX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C24H20P.BHO3/c2*1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3)4/h2*1-20H;2H/q2*+1;-2.
What are the key properties of hydrogen borate;bis(tetraphenylphosphanium)?
hydrogen borate;bis(tetraphenylphosphanium) has a molecular weight of 738.61 g/mol, XLogP of 5.30, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen borate;bis(tetraphenylphosphanium) is sourced from PubChem (CID 174383886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).