About boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium
boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium (PubChem CID 175447318) has the molecular formula C54H47BO4P2+2
and a molecular weight of 832.73 g/mol. Its IUPAC name is boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium.
Molecular Properties
| Compound Name | boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium |
| PubChem CID | 175447318 |
| Molecular Formula | C54H47BO4P2+2 |
| Molecular Weight | 832.73 g/mol |
| Exact Mass | 832.30 |
| IUPAC Name | boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium |
| SMILES | OB(O)O.c1ccc(Oc2ccccc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24OP.C24H20P.BH3O3/c1-5-15-25(16-6-1)31-29-23-13-14-24-30(29)32(26-17-7-2-8-18-26,27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3)4/h1-24H;1-20H;2-4H/q2*+1; |
| InChIKey | FJXYEZZRNWUVQW-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 832.73 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium?
The IUPAC name of boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium (CID 175447318) is boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium.
What is the SMILES notation for boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium?
The canonical SMILES for boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium is OB(O)O.c1ccc(Oc2ccccc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium?
The InChIKey is FJXYEZZRNWUVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24OP.C24H20P.BH3O3/c1-5-15-25(16-6-1)31-29-23-13-14-24-30(29)32(26-17-7-2-8-18-26,27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3)4/h1-24H;1-20H;2-4H/q2*+1;.
What are the key properties of boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium?
boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium has a molecular weight of 832.73 g/mol, XLogP of 8.35, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;(2-phenoxyphenyl)-triphenylphosphanium;tetraphenylphosphanium is sourced from PubChem (CID 175447318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).