About 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride
2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride (PubChem CID 173469138) has the molecular formula C12H15ClF4OS
and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride.
Molecular Properties
| Compound Name | 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride |
| PubChem CID | 173469138 |
| Molecular Formula | C12H15ClF4OS |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride |
| SMILES | Cl.F.F.F.F.Sc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C12H10OS.ClH.4FH/c14-12-9-5-4-8-11(12)13-10-6-2-1-3-7-10;;;;;/h1-9,14H;5*1H |
| InChIKey | OVJSWOUANSJZEB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride?
The IUPAC name of 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride (CID 173469138) is 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride.
What is the SMILES notation for 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride?
The canonical SMILES for 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride is Cl.F.F.F.F.Sc1ccccc1Oc1ccccc1.
What is the InChIKey of 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride?
The InChIKey is OVJSWOUANSJZEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OS.ClH.4FH/c14-12-9-5-4-8-11(12)13-10-6-2-1-3-7-10;;;;;/h1-9,14H;5*1H.
What are the key properties of 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride?
2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride has a molecular weight of 318.76 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxybenzenethiol;hydrochloride;tetrahydrofluoride is sourced from PubChem (CID 173469138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).