About tetraphenylphosphanium;trifluorophosphane
tetraphenylphosphanium;trifluorophosphane (PubChem CID 175419552) has the molecular formula C24H20F3P2+
and a molecular weight of 427.37 g/mol. Its IUPAC name is tetraphenylphosphanium;trifluorophosphane.
Molecular Properties
| Compound Name | tetraphenylphosphanium;trifluorophosphane |
| PubChem CID | 175419552 |
| Molecular Formula | C24H20F3P2+ |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | tetraphenylphosphanium;trifluorophosphane |
| SMILES | FP(F)F.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.F3P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4(2)3/h1-20H;/q+1; |
| InChIKey | QXERWKMZQJANHF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylphosphanium;trifluorophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylphosphanium;trifluorophosphane?
The IUPAC name of tetraphenylphosphanium;trifluorophosphane (CID 175419552) is tetraphenylphosphanium;trifluorophosphane.
What is the SMILES notation for tetraphenylphosphanium;trifluorophosphane?
The canonical SMILES for tetraphenylphosphanium;trifluorophosphane is FP(F)F.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylphosphanium;trifluorophosphane?
The InChIKey is QXERWKMZQJANHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20P.F3P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4(2)3/h1-20H;/q+1;.
What are the key properties of tetraphenylphosphanium;trifluorophosphane?
tetraphenylphosphanium;trifluorophosphane has a molecular weight of 427.37 g/mol, XLogP of 6.43, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylphosphanium;trifluorophosphane is sourced from PubChem (CID 175419552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).