C57H45P6+3 — CID 134915224
[4,6-bis(triphenylphosphaniumyl)-1,3,5-triphosphinin-2-yl]-triphenylphosphanium (PubChem CID 134915224) has the molecular formula C57H45P6+3 and a molecular weight of 915.83 g/mol. Its IUPAC name is [4,6-bis(triphenylphosphaniumyl)-1,3,5-triphosphinin-2-yl]-triphenylphosphanium.
| Compound Name | [4,6-bis(triphenylphosphaniumyl)-1,3,5-triphosphinin-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 134915224 |
| Molecular Formula | C57H45P6+3 |
| Molecular Weight | 915.83 g/mol |
| Exact Mass | 915.19 |
| IUPAC Name | [4,6-bis(triphenylphosphaniumyl)-1,3,5-triphosphinin-2-yl]-triphenylphosphanium |
| SMILES | c1ccc([P+](c2ccccc2)(c2ccccc2)c2pc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)pc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)p2)cc1 |
| InChI | InChI=1S/C57H45P6/c1-10-28-46(29-11-1)61(47-30-12-2-13-31-47,48-32-14-3-15-33-48)55-58-56(62(49-34-16-4-17-35-49,50-36-18-5-19-37-50)51-38-20-6-21-39-51)60-57(59-55)63(52-40-22-7-23-41-52,53-42-24-8-25-43-53)54-44-26-9-27-45-54/h1-45H/q+3 |
| InChIKey | HZEPMBURANEYAE-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.83 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|