C62H50P4+2 — CID 23280121
triphenyl-(1,1,3,3-tetraphenyl-4-triphenylphosphaniumyl-1λ5,3λ5-diphosphacyclobuta-1,3-dien-2-yl)phosphanium (PubChem CID 23280121) has the molecular formula C62H50P4+2 and a molecular weight of 918.98 g/mol. Its IUPAC name is triphenyl-(1,1,3,3-tetraphenyl-4-triphenylphosphaniumyl-1λ5,3λ5-diphosphacyclobuta-1,3-dien-2-yl)phosphanium.
| Compound Name | triphenyl-(1,1,3,3-tetraphenyl-4-triphenylphosphaniumyl-1λ5,3λ5-diphosphacyclobuta-1,3-dien-2-yl)phosphanium |
|---|---|
| PubChem CID | 23280121 |
| Molecular Formula | C62H50P4+2 |
| Molecular Weight | 918.98 g/mol |
| Exact Mass | 918.29 |
| IUPAC Name | triphenyl-(1,1,3,3-tetraphenyl-4-triphenylphosphaniumyl-1λ5,3λ5-diphosphacyclobuta-1,3-dien-2-yl)phosphanium |
| SMILES | c1ccc(P2(c3ccccc3)=C([P+](c3ccccc3)(c3ccccc3)c3ccccc3)P(c3ccccc3)(c3ccccc3)=C2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C62H50P4/c1-11-31-51(32-12-1)63(52-33-13-2-14-34-52,53-35-15-3-16-36-53)61-65(57-43-23-7-24-44-57,58-45-25-8-26-46-58)62(66(61,59-47-27-9-28-48-59)60-49-29-10-30-50-60)64(54-37-17-4-18-38-54,55-39-19-5-20-40-55)56-41-21-6-22-42-56/h1-50H/q+2 |
| InChIKey | DYKFXPMFCIQJJF-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.98 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|