About CID 174725022
CID 174725022 (PubChem CID 174725022) has the molecular formula C28H29BP+
and a molecular weight of 407.33 g/mol.
Molecular Properties
| Compound Name | CID 174725022 |
| PubChem CID | 174725022 |
| Molecular Formula | C28H29BP+ |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | — |
| SMILES | [B]CCCC.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C4H9B/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-4-5/h1-20H;2-4H2,1H3/q+1; |
| InChIKey | RZDQIXUWXNPEDR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174725022 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174725022?
The IUPAC name of CID 174725022 (CID 174725022) is not available.
What is the SMILES notation for CID 174725022?
The canonical SMILES for CID 174725022 is [B]CCCC.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 174725022?
The InChIKey is RZDQIXUWXNPEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20P.C4H9B/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-4-5/h1-20H;2-4H2,1H3/q+1;.
What are the key properties of CID 174725022?
CID 174725022 has a molecular weight of 407.33 g/mol, XLogP of 5.68, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174725022 is sourced from PubChem (CID 174725022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).