About palladium;triphenyl(sulfido)phosphanium
palladium;triphenyl(sulfido)phosphanium (PubChem CID 172554124) has the molecular formula C18H15PPdS
and a molecular weight of 400.78 g/mol. Its IUPAC name is palladium;triphenyl(sulfido)phosphanium.
Molecular Properties
| Compound Name | palladium;triphenyl(sulfido)phosphanium |
| PubChem CID | 172554124 |
| Molecular Formula | C18H15PPdS |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | palladium;triphenyl(sulfido)phosphanium |
| SMILES | [Pd].[S-][P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15PS.Pd/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H; |
| InChIKey | ZRYASQOQBAIIII-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze palladium;triphenyl(sulfido)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;triphenyl(sulfido)phosphanium?
The IUPAC name of palladium;triphenyl(sulfido)phosphanium (CID 172554124) is palladium;triphenyl(sulfido)phosphanium.
What is the SMILES notation for palladium;triphenyl(sulfido)phosphanium?
The canonical SMILES for palladium;triphenyl(sulfido)phosphanium is [Pd].[S-][P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of palladium;triphenyl(sulfido)phosphanium?
The InChIKey is ZRYASQOQBAIIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15PS.Pd/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;.
What are the key properties of palladium;triphenyl(sulfido)phosphanium?
palladium;triphenyl(sulfido)phosphanium has a molecular weight of 400.78 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;triphenyl(sulfido)phosphanium is sourced from PubChem (CID 172554124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).