C25H35BO3 — CID 122381145
4-[phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,6-di(propan-2-yl)phenol (PubChem CID 122381145) has the molecular formula C25H35BO3 and a molecular weight of 394.36 g/mol. Its IUPAC name is 4-[phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,6-di(propan-2-yl)phenol.
| Compound Name | 4-[phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 122381145 |
| Molecular Formula | C25H35BO3 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-[phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(C(B2OC(C)(C)C(C)(C)O2)c2ccccc2)cc(C(C)C)c1O |
| InChI | InChI=1S/C25H35BO3/c1-16(2)20-14-19(15-21(17(3)4)23(20)27)22(18-12-10-9-11-13-18)26-28-24(5,6)25(7,8)29-26/h9-17,22,27H,1-8H3 |
| InChIKey | FLFPZMZSSSNYMK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|