C12H18N2O2S — CID 115269150
1-(benzenesulfonyl)-5,5-dimethylpyrrolidin-3-amine (PubChem CID 115269150) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5,5-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(benzenesulfonyl)-5,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115269150 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(benzenesulfonyl)-5,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)CC(N)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-12(2)8-10(13)9-14(12)17(15,16)11-6-4-3-5-7-11/h3-7,10H,8-9,13H2,1-2H3 |
| InChIKey | GVYNCOIWAWAVEX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |