C20H25NO2S — CID 156698182
1-(benzenesulfonyl)-2,2-diethyl-4-phenylpyrrolidine (PubChem CID 156698182) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,2-diethyl-4-phenylpyrrolidine.
| Compound Name | 1-(benzenesulfonyl)-2,2-diethyl-4-phenylpyrrolidine |
|---|---|
| PubChem CID | 156698182 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(benzenesulfonyl)-2,2-diethyl-4-phenylpyrrolidine |
| SMILES | CCC1(CC)CC(c2ccccc2)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2S/c1-3-20(4-2)15-18(17-11-7-5-8-12-17)16-21(20)24(22,23)19-13-9-6-10-14-19/h5-14,18H,3-4,15-16H2,1-2H3 |
| InChIKey | MEWKDVYVCGPASE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |