C18H20N2O4S — CID 156698197
2,2-dimethyl-1-(4-nitrophenyl)sulfonyl-4-phenylpyrrolidine (PubChem CID 156698197) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-nitrophenyl)sulfonyl-4-phenylpyrrolidine.
| Compound Name | 2,2-dimethyl-1-(4-nitrophenyl)sulfonyl-4-phenylpyrrolidine |
|---|---|
| PubChem CID | 156698197 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2,2-dimethyl-1-(4-nitrophenyl)sulfonyl-4-phenylpyrrolidine |
| SMILES | CC1(C)CC(c2ccccc2)CN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-18(2)12-15(14-6-4-3-5-7-14)13-19(18)25(23,24)17-10-8-16(9-11-17)20(21)22/h3-11,15H,12-13H2,1-2H3 |
| InChIKey | DDUZZCQNRLKJAQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|