C11H12N2O6S — CID 102155324
methyl (2R)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine-2-carboxylate (PubChem CID 102155324) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is methyl (2R)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | methyl (2R)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 102155324 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | methyl (2R)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H12N2O6S/c1-11(10(14)19-2)7-12(11)20(17,18)9-5-3-8(4-6-9)13(15)16/h3-6H,7H2,1-2H3/t11-,12?/m1/s1 |
| InChIKey | NSOZSCPNEWXYKP-JHJMLUEUSA-N |
| XLogP | 0.53 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|