C18H24N2O8S2 — CID 139095675
dimethyl (2S,4R)-4-tert-butylsulfanyl-1-(4-nitrophenyl)sulfonylpyrrolidine-2,4-dicarboxylate (PubChem CID 139095675) has the molecular formula C18H24N2O8S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is dimethyl (2S,4R)-4-tert-butylsulfanyl-1-(4-nitrophenyl)sulfonylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2S,4R)-4-tert-butylsulfanyl-1-(4-nitrophenyl)sulfonylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 139095675 |
| Molecular Formula | C18H24N2O8S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | dimethyl (2S,4R)-4-tert-butylsulfanyl-1-(4-nitrophenyl)sulfonylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@](SC(C)(C)C)(C(=O)OC)CN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H24N2O8S2/c1-17(2,3)29-18(16(22)28-5)10-14(15(21)27-4)19(11-18)30(25,26)13-8-6-12(7-9-13)20(23)24/h6-9,14H,10-11H2,1-5H3/t14-,18+/m0/s1 |
| InChIKey | FGQHUZYNVKQRDE-KBXCAEBGSA-N |
| XLogP | 1.97 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|