C17H15NO7S — CID 139191139
methyl (2R,3S,6S,7R)-1-(4-nitrophenyl)sulfonyloxypentacyclo[4.3.0.02,5.03,8.04,7]nonane-4-carboxylate (PubChem CID 139191139) has the molecular formula C17H15NO7S and a molecular weight of 377.37 g/mol. Its IUPAC name is methyl (2R,3S,6S,7R)-1-(4-nitrophenyl)sulfonyloxypentacyclo[4.3.0.02,5.03,8.04,7]nonane-4-carboxylate.
| Compound Name | methyl (2R,3S,6S,7R)-1-(4-nitrophenyl)sulfonyloxypentacyclo[4.3.0.02,5.03,8.04,7]nonane-4-carboxylate |
|---|---|
| PubChem CID | 139191139 |
| Molecular Formula | C17H15NO7S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | methyl (2R,3S,6S,7R)-1-(4-nitrophenyl)sulfonyloxypentacyclo[4.3.0.02,5.03,8.04,7]nonane-4-carboxylate |
| SMILES | COC(=O)C12C3[C@@H]4[C@H]1C1CC4(OS(=O)(=O)c4ccc([N+](=O)[O-])cc4)[C@@H]3[C@H]12 |
| InChI | InChI=1S/C17H15NO7S/c1-24-15(19)17-10-9-6-16(12(10)14(17)13(16)11(9)17)25-26(22,23)8-4-2-7(3-5-8)18(20)21/h2-5,9-14H,6H2,1H3/t9?,10-,11+,12+,13-,14?,16?,17? |
| InChIKey | XQAFKMZTJXHRLR-HETAGWCJSA-N |
| XLogP | 1.35 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|