C21H29N3O6S — CID 175786571
tert-butyl 2-(4-nitrophenyl)sulfonyl-2,10-diazadispiro[2.0.44.43]dodecane-10-carboxylate (PubChem CID 175786571) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is tert-butyl 2-(4-nitrophenyl)sulfonyl-2,10-diazadispiro[2.0.44.43]dodecane-10-carboxylate.
| Compound Name | tert-butyl 2-(4-nitrophenyl)sulfonyl-2,10-diazadispiro[2.0.44.43]dodecane-10-carboxylate |
|---|---|
| PubChem CID | 175786571 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | tert-butyl 2-(4-nitrophenyl)sulfonyl-2,10-diazadispiro[2.0.44.43]dodecane-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CN2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C2(CCCC2)C1 |
| InChI | InChI=1S/C21H29N3O6S/c1-19(2,3)30-18(25)22-13-12-21(20(14-22)10-4-5-11-20)15-23(21)31(28,29)17-8-6-16(7-9-17)24(26)27/h6-9H,4-5,10-15H2,1-3H3 |
| InChIKey | VPYHBGODLYOAAS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|