C17H24N4O5 — CID 118417462
tert-butyl 4-carbamoyl-4-(4-nitroanilino)piperidine-1-carboxylate (PubChem CID 118417462) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is tert-butyl 4-carbamoyl-4-(4-nitroanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-carbamoyl-4-(4-nitroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118417462 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | tert-butyl 4-carbamoyl-4-(4-nitroanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc([N+](=O)[O-])cc2)(C(N)=O)CC1 |
| InChI | InChI=1S/C17H24N4O5/c1-16(2,3)26-15(23)20-10-8-17(9-11-20,14(18)22)19-12-4-6-13(7-5-12)21(24)25/h4-7,19H,8-11H2,1-3H3,(H2,18,22) |
| InChIKey | BDBIAAZHIAQIRE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|