About tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene
tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene (PubChem CID 87304540) has the molecular formula C16H22N2O6S
and a molecular weight of 370.43 g/mol. Its IUPAC name is tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene.
Molecular Properties
| Compound Name | tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene |
| PubChem CID | 87304540 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene |
| SMILES | CC(C)(C)OC(=O)N1CCC(=S(=O)=O)CC1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C10H17NO4S.C6H5NO2/c1-10(2,3)15-9(12)11-6-4-8(5-7-11)16(13)14;8-7(9)6-4-2-1-3-5-6/h4-7H2,1-3H3;1-5H |
| InChIKey | NFOCNLCBFWKFNY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene?
The IUPAC name of tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene (CID 87304540) is tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene.
What is the SMILES notation for tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene?
The canonical SMILES for tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene is CC(C)(C)OC(=O)N1CCC(=S(=O)=O)CC1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene?
The InChIKey is NFOCNLCBFWKFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4S.C6H5NO2/c1-10(2,3)15-9(12)11-6-4-8(5-7-11)16(13)14;8-7(9)6-4-2-1-3-5-6/h4-7H2,1-3H3;1-5H.
What are the key properties of tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene?
tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene has a molecular weight of 370.43 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-sulfonylpiperidine-1-carboxylate;nitrobenzene is sourced from PubChem (CID 87304540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).