C22H32FNO5S — CID 170560980
tert-butyl 10-(benzylsulfonyloxymethyl)-10-fluoro-7-azaspiro[4.5]decane-7-carboxylate (PubChem CID 170560980) has the molecular formula C22H32FNO5S and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl 10-(benzylsulfonyloxymethyl)-10-fluoro-7-azaspiro[4.5]decane-7-carboxylate.
| Compound Name | tert-butyl 10-(benzylsulfonyloxymethyl)-10-fluoro-7-azaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 170560980 |
| Molecular Formula | C22H32FNO5S |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | tert-butyl 10-(benzylsulfonyloxymethyl)-10-fluoro-7-azaspiro[4.5]decane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(COS(=O)(=O)Cc2ccccc2)C2(CCCC2)C1 |
| InChI | InChI=1S/C22H32FNO5S/c1-20(2,3)29-19(25)24-14-13-22(23,21(16-24)11-7-8-12-21)17-28-30(26,27)15-18-9-5-4-6-10-18/h4-6,9-10H,7-8,11-17H2,1-3H3 |
| InChIKey | LVRKHXBQCCXKTB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|