C18H16F4N6O9S2 — CID 10627405
1-N,1-N,5-N,5-N-tetrafluoro-3,7-bis[(4-nitrophenyl)sulfonyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-1,5-diamine (PubChem CID 10627405) has the molecular formula C18H16F4N6O9S2 and a molecular weight of 600.49 g/mol. Its IUPAC name is 1-N,1-N,5-N,5-N-tetrafluoro-3,7-bis[(4-nitrophenyl)sulfonyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-1,5-diamine.
| Compound Name | 1-N,1-N,5-N,5-N-tetrafluoro-3,7-bis[(4-nitrophenyl)sulfonyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-1,5-diamine |
|---|---|
| PubChem CID | 10627405 |
| Molecular Formula | C18H16F4N6O9S2 |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 600.04 |
| IUPAC Name | 1-N,1-N,5-N,5-N-tetrafluoro-3,7-bis[(4-nitrophenyl)sulfonyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-1,5-diamine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CC3(N(F)F)CN(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)CC(N(F)F)(C2)O3)cc1 |
| InChI | InChI=1S/C18H16F4N6O9S2/c19-27(20)17-9-23(38(33,34)15-5-1-13(2-6-15)25(29)30)10-18(37-17,28(21)22)12-24(11-17)39(35,36)16-7-3-14(4-8-16)26(31)32/h1-8H,9-12H2 |
| InChIKey | XJCLZIPWYJZYNQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 176.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|