C13H17N3O4S — CID 162367513
[(1R,6S)-3-(4-nitrophenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-6-yl]methanamine (PubChem CID 162367513) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is [(1R,6S)-3-(4-nitrophenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-6-yl]methanamine.
| Compound Name | [(1R,6S)-3-(4-nitrophenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-6-yl]methanamine |
|---|---|
| PubChem CID | 162367513 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [(1R,6S)-3-(4-nitrophenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-6-yl]methanamine |
| SMILES | NC[C@@]12CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C[C@@H]1C2 |
| InChI | InChI=1S/C13H17N3O4S/c14-9-13-5-6-15(8-10(13)7-13)21(19,20)12-3-1-11(2-4-12)16(17)18/h1-4,10H,5-9,14H2/t10-,13-/m0/s1 |
| InChIKey | DAGHADZKARDXHR-GWCFXTLKSA-N |
| XLogP | 0.95 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|